BD3142045
(2S)-1-[(1S)-1-[Bis(1,1-dimethylethyl)phosphino]ethyl]-2-(diphenylphosphino)ferrocene , 98%99%ee , 277306-29-3
Synonym(s):
(2S)-1-[(1S)-1-[Bis(1,1-dimethylethyl)phosphino]ethyl]-2-(diphenylphosphino)ferrocene (acc to CAS);Josiphos SL-J002-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB52.00 | In Stock |
|
| 250mg | RMB97.60 | In Stock |
|
| 1g | RMB295.20 | In Stock |
|
| 5g | RMB1049.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | +412° ±15° (c 0.5, CHCl3) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder |
| color | orange |
| optical activity | [α]20/D +410±15°, c = 0.5 in chloroform |
| InChI | 1S/C27H35P2.C5H5.Fe/c1-21(29(26(2,3)4)27(5,6)7)24-19-14-20-25(24)28(22-15-10-8-11-16-22)23-17-12-9-13-18-23;1-2-4-5-3-1;/h8-21H,1-7H3;1-5H;/t21-;;/m0../s1 |
| InChIKey | STAGMXYQPGLLTD-FGJQBABTSA-N |
| SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.C[C@@H]([C]2[CH][CH][CH][C]2P(c3ccccc3)c4ccccc4)P(C(C)(C)C)C(C)(C)C |
Description and Uses
(S)-1-[(RP)-2-(Diphenylphosphino)ferrocenyl]ethyldi-tert-butylphosphine is β-boration catalyst; used in preparation of Sitagliptin β-Amino-2,4,5-trifluorobenzenebutanoic Acid derivatives intermediates via Grignard exchange reaction, cross coupling, β-boration, oxidation and Amination.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |

![(2S)-1-[(1S)-1-[Bis(1,1-dimethylethyl)phosphino]ethyl]-2-(diphenylphosphino)ferrocene](https://img.chemicalbook.com/CAS/GIF/277306-29-3.gif)

![(2S)-1-[(1S)-1-(Dicyclohexylphosphino)ethyl]-2-(diphenylphosphino)ferrocene](https://img.chemicalbook.com/CAS/GIF/162291-02-3.gif)
![(S)-(+)-1-[(R)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine](https://img.chemicalbook.com/CAS/GIF/158923-07-0.gif)

