BD3165245
H-Serinol(Bzl) , 97% , 58577-87-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB113.60 | In Stock |
|
| 1g | RMB283.20 | In Stock |
|
| 5g | RMB1000.00 | In Stock |
|
| 10g | RMB1700.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-37 °C (lit.) |
| Boiling point: | 307 °C (lit.) |
| Density | 1.0918 (rough estimate) |
| refractive index | 1.5464 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 12.53±0.10(Predicted) |
| color | Clear Colourless |
| optical activity | [α]20/D +4°, c = 1 in methylene chloride |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C10H15NO2/c11-10(6-12)8-13-7-9-4-2-1-3-5-9/h1-5,10,12H,6-8,11H2/t10-/m1/s1 |
| InChIKey | ZJUOMDNENVWMPL-SNVBAGLBSA-N |
| SMILES | C(O)[C@@H](N)COCC1=CC=CC=C1 |
Description and Uses
(R)-(+)-2-Amino-3-benzyloxy-1-propanol is used as a reagent to synthesize beta-amino alcohols, compounds that are used as therapeutic agents to treat heart disease. (R)-(+)-2-Amino-3-benzyloxy-1-propanol is also used as a reagent to synthesize 15-membered macrolide antibiotics, drugs that are used to treat respiratory tract infections.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | 3267 |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 29221990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |







