BD3175248
3-(Boc-amino)-2,2-dimethylpropionicAcid , 98% , 180181-02-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB100.80 | In Stock |
|
| 250mg | RMB172.80 | In Stock |
|
| 1g | RMB454.40 | In Stock |
|
| 5g | RMB1592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 346.5±25.0 °C(Predicted) |
| Density | 1.082±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 4.61±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C10H18O4/c1-9(2,3)14-7(11)6-10(4,5)8(12)13/h6H2,1-5H3,(H,12,13) |
| InChIKey | BCUIGUVXRMEZDV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(CC(C)(C(O)=O)C)=O |
Description and Uses
2,2-Dimethyl-β-alanine-N-(tert-butoxycarbonyl) is used as a reactant in the synthesis of cryptophycin anticancer agents.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| WGK Germany | WGK 3 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
