BD3181445
N-Phenylhydrazinecarbothioamide , 98% , 5351-69-9
CAS NO.:5351-69-9
Empirical Formula: C7H9N3S
Molecular Weight: 167.23
MDL number: MFCD00007615
EINECS: 226-329-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB70.40 | In Stock |
|
| 10g | RMB136.00 | In Stock |
|
| 25g | RMB331.20 | In Stock |
|
| 100g | RMB1302.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C (lit.) |
| Boiling point: | 287.4±23.0 °C(Predicted) |
| Density | 1.1960 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | methanol: 50 mg/mL, clear |
| form | powder to crystal |
| pka | 11.01±0.70(Predicted) |
| color | White to Almost white |
| BRN | 608285 |
| InChI | InChI=1S/C7H9N3S/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
| InChIKey | KKIGUVBJOHCXSP-UHFFFAOYSA-N |
| SMILES | N(C(NC1=CC=CC=C1)=S)N |
| CAS DataBase Reference | 5351-69-9(CAS DataBase Reference) |
| EPA Substance Registry System | Hydrazinecarbothioamide, N-phenyl- (5351-69-9) |
Description and Uses
4-Phenylthiosemicarbazide was used in the synthesis of amberlite XAD resins. It was also used in the synthesis of a series of thiosemicarbazones.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | VT4025000 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
| Limited Quantities | 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |







