BD3182745
Calcium2-oxopropanoate , 95% , 52009-14-0
CAS NO.：52009-14-0
Empirical Formula: C3H6CaO3
Molecular Weight: 130.16
MDL number: MFCD00037199
EINECS: 257-599-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB27.20 | In Stock |
|
| 100g | RMB95.20 | In Stock |
|
| 500g | RMB318.40 | In Stock |
|
| 1000g | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >245°C (dec.) |
| Density | 890 at 25℃ |
| vapor pressure | 1.24hPa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water (Sparingly, Heated) |
| form | Solid |
| color | White to Pale Yellow |
| InChI | InChI=1S/C3H4O3.Ca.2H/c1-2(4)3(5)6;;;/h1H3,(H,5,6);;; |
| InChIKey | HLRZKDSZFMBROZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C)C(=O)O.[Ca] |
| LogP | -1.24 at 25℃ and pH7 |
| CAS DataBase Reference | 52009-14-0(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 2-oxo-, calcium salt (2:1) (52009-14-0) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
