BD3216445
1,4-Di([2,2':6',2''-terpyridin]-4'-yl)benzene , 97% , 146406-75-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB112.00 | In Stock |
|
| 250mg | RMB233.60 | In Stock |
|
| 1g | RMB779.20 | In Stock |
|
| 5g | RMB3162.40 | In Stock |
|
| 25g | RMB11040.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 340 °C (dec.)(lit.) |
| Boiling point: | 727.8±55.0 °C(Predicted) |
| Density | 1.227±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 4.73±0.22(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| λmax | 292nm(CH2Cl2)(lit.) |
| InChIKey | NXMHYAQTBVTLRK-UHFFFAOYSA-N |
| SMILES | C1(C2C=C(C3=NC=CC=C3)N=C(C3=NC=CC=C3)C=2)=CC=C(C2C=C(C3=NC=CC=C3)N=C(C3=NC=CC=C3)C=2)C=C1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2933.39.9200 |

![1,4-Di([2,2':6',2''-terpyridin]-4'-yl)benzene](https://img.chemicalbook.com/CAS/GIF/146406-75-9.gif)




![[2,2'-Bipyridine]-4,4'-diyldiphosphonicacid](https://img.chemicalbook.com/CAS/GIF/194800-56-1.gif)