BD3216445
                    1,4-Di([2,2':6',2''-terpyridin]-4'-yl)benzene , 97% , 146406-75-9
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB112.00 | In Stock |  | 
| 250mg | RMB233.60 | In Stock |  | 
| 1g | RMB779.20 | In Stock |  | 
| 5g | RMB3162.40 | In Stock |  | 
| 25g | RMB11040.00 | In Stock |  | 
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 340 °C (dec.)(lit.) | 
| Boiling point: | 727.8±55.0 °C(Predicted) | 
| Density | 1.227±0.06 g/cm3(Predicted) | 
| storage temp. | Inert atmosphere,Room Temperature | 
| pka | 4.73±0.22(Predicted) | 
| form | powder to crystal | 
| color | White to Yellow to Orange | 
| λmax | 292nm(CH2Cl2)(lit.) | 
| InChIKey | NXMHYAQTBVTLRK-UHFFFAOYSA-N | 
| SMILES | C1(C2C=C(C3=NC=CC=C3)N=C(C3=NC=CC=C3)C=2)=CC=C(C2C=C(C3=NC=CC=C3)N=C(C3=NC=CC=C3)C=2)C=C1 | 
Safety
| Symbol(GHS) |  GHS07 | 
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| RIDADR | UN 2811 6.1/PG 3 | 
| WGK Germany | 3 | 
| HS Code | 2933.39.9200 | 

![1,4-Di([2,2':6',2''-terpyridin]-4'-yl)benzene](https://img.chemicalbook.com/CAS/GIF/146406-75-9.gif)



![[2,2'-Bipyridine]-4,4'-diyldiphosphonicacid](https://img.chemicalbook.com/CAS/GIF/194800-56-1.gif)