BD3227345
(4R,5S)-(+)-4-Methyl-5-phenyl-2-oxazolidinone , 97% , 77943-39-6
Synonym(s):
(4R,5S)-4-Methyl-5-phenyl-2-oxazolidinone
| Pack Size | Price | Stock | Quantity |
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB248.80 | In Stock |
|
| 10g | RMB456.80 | In Stock |
|
| 25g | RMB993.60 | In Stock |
|
| 100g | RMB3157.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-123 °C(lit.) |
| Boiling point: | 309.12°C (rough estimate) |
| Density | 1.1607 (rough estimate) |
| refractive index | 1.5168 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| pka | 12.35±0.60(Predicted) |
| color | Clear colorless to yellow-brown, may darken in storage |
| optical activity | [α]18/D +168°, c = 2 in chloroform |
| BRN | 1211705 |
| InChI | InChI=1S/C10H11NO2/c1-7-9(13-10(12)11-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H,11,12)/t7-,9-/m1/s1 |
| InChIKey | PPIBJOQGAJBQDF-VXNVDRBHSA-N |
| SMILES | O1[C@@H](C2=CC=CC=C2)[C@@H](C)NC1=O |
| CAS DataBase Reference | 77943-39-6(CAS DataBase Reference) |
Description and Uses
Evan′s chiral auxiliary (4R,5S)-(+)-4-Methyl-5-phenyl-2-oxazolidinone reacts with carboxylic acids to produce corresponding acyl derivatives in the presence of a diisopropylcarbodiimide reagent. It can also employed in the preparation of N-sulfinyloxazolidinone reagent (chiral sulfinyl transfer reagent), which reacts with nucleophiles such as Grignard reagents, enolates, and metalated amides to produce the chiral sulfoxides, sulfinate esters, and sulfonamides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | N |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |







