BD3232048
(1R,2R,5R)-2-Hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one , 98% , 24047-72-1
Synonym(s):
(1R,2R,5R)-2-Hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one
| Pack Size | Price | Stock | Quantity |
| 1g | RMB244.80 | In Stock |
|
| 5g | RMB752.80 | In Stock |
|
| 25g | RMB2530.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39 °C (lit.) |
| Boiling point: | 245 °C (lit.) |
| Density | 1.059 g/mL at 25 °C (lit.) |
| refractive index | 33 ° (C=0.5, CHCl3) |
| Flash point: | 224 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| pka | 12.93±0.40(Predicted) |
| color | Colourless to Pale Yellow |
| optical activity | [α]20/D +39°, c = 0.5 in chloroform |
| BRN | 2249018 |
| InChI | 1S/C10H16O2/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-7,12H,4-5H2,1-3H3/t6-,7-,10/m1/s1 |
| InChIKey | VZRRCQOUNSHSGB-KTWZPZHPSA-N |
| SMILES | CC1(C)[C@@H]2C[C@H]1C(C)(O)C(=O)C2 |
| CAS DataBase Reference | 24047-72-1(CAS DataBase Reference) |
Description and Uses
(1R,2R,5R)-(+)-2-Hydroxy-3-pinanone is a useful chiral auxillary for synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2914.40.9000 |
| Storage Class | 11 - Combustible Solids |

![(1R,2R,5R)-2-Hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one](https://img.chemicalbook.com/CAS/GIF/24047-72-1.gif)



