PRODUCT Properties
| Melting point: | 241-242 °C(Solv: ethanol (64-17-5)) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 1.127±0.10(predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C4H8O2S/c1-7(2)3-4(5)6/h3H2,1-2H3 |
| InChIKey | PSBDWGZCVUAZQS-UHFFFAOYSA-N |
| SMILES | C([O-])(=O)C[S+](C)C |
Description and Uses
Sulfobetaine Hydrochloride is HCl form of Sulfobetaine (CAS 4727-41-7) which is a zwitterionic metabolite involved in the osmoadaption of phytoplankton.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
