BD3241645
2-(1,3-Dioxoisoindolin-2-yl)acetylchloride , 97% , 6780-38-7
Synonym(s):
1,3-Dioxo-2-isoindolineacetyl chloride;NSC 401729;Phthalylglycine acid chloride
CAS NO.：6780-38-7
Empirical Formula: C10H6ClNO3
Molecular Weight: 223.61
MDL number: MFCD00192872
EINECS: 229-840-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB100.00 | In Stock |
|
| 1g | RMB250.40 | In Stock |
|
| 5g | RMB775.20 | In Stock |
|
| 10g | RMB1364.00 | In Stock |
|
| 25g | RMB2728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-85 °C |
| Boiling point: | 190-192 °C(Press: 15 Torr) |
| Density | 1.504±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform, Dichloromethane |
| pka | -2.56±0.20(Predicted) |
| form | Solid |
| color | White |
| InChI | 1S/C10H6ClNO3/c11-8(13)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4H,5H2 |
| InChIKey | RHZBRCQIKQUQHQ-UHFFFAOYSA-N |
| SMILES | ClC(=O)CN1C(=O)c2ccccc2C1=O |
Description and Uses
Phthalylglycyl chloride can be used in the synthesis of N-Phthalimidoacetyl-β-phenylethylamnine.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2923 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
