BD3243845
PhosphocholineChlorideCalciumSaltTetrahydrate , 98% , 4826-71-5
CAS NO.:4826-71-5
Empirical Formula: C5H13NO4P.Ca.Cl
Molecular Weight: 257.67
MDL number: MFCD00011755
EINECS: 225-403-0
| Pack Size | Price | Stock | Quantity |
| 10g | RMB59.20 | In Stock |
|
| 25g | RMB96.00 | In Stock |
|
| 100g | RMB156.80 | In Stock |
|
| 500g | RMB747.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.613[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| Water Solubility | 203.458g/L at 20℃ |
| Merck | 7362 |
| InChI | InChI=1S/C5H14NO4P.Ca.ClH/c1-6(2,3)4-5-10-11(7,8)9;;/h4-5H2,1-3H3,(H-,7,8,9);;1H/q;+2;/p-2 |
| InChIKey | ICVPTJCCKTXCDT-UHFFFAOYSA-L |
| SMILES | C(COP([O-])([O-])=O)[N+](C)(C)C.[Ca+2].[Cl-] |
| LogP | -2.3 at 20℃ |
| CAS DataBase Reference | 4826-71-5(CAS DataBase Reference) |
Description and Uses
Phosphocholine chloride calcium salt is a useful research chemical for organic synthesis. It is used in the improved synthesis of 6-??(O-??phosphorylcholine)??hydroxyhexanoic acid.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H335-H360 |
| Precautionary statements | P201-P261-P280-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-21 |




