BD3243945
7-Hydroxy-2-oxo-2H-chromene-3-carboxylicacid , 98% , 779-27-1
CAS NO.:779-27-1
Empirical Formula: C10H6O5
Molecular Weight: 206.15
MDL number: MFCD00017491
EINECS: 1415-596-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB96.00 | In Stock |
|
| 250mg | RMB145.60 | In Stock |
|
| 1g | RMB296.80 | In Stock |
|
| 5g | RMB1042.40 | In Stock |
|
| 25g | RMB3689.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261 °C(lit.) |
| Boiling point: | 474.8±45.0 °C(Predicted) |
| Density | 1.639±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.04 ± 0.02, temperature: 23 °C |
| color | Yellow solid;Orange solid;
Off-white powder |
| λmax | 386 nm (Buffer pH 10.0); 339 nm
(Buffer pH 4.0) |
| BRN | 384141 |
| Major Application | Carbon-dioxide sensor;
chemical sensors based on non-linear optics;
monitoring of cationic photopolymerization processes;
nanomaterials |
| Biological Applications | Chemical dosimeter
for radiation therapy; detecting bacteria;
detecting/sensing hydroxyl radicals; studying
nucleic acids; as a substrate for measuring
carboxylesterases activity, cellulases activity,
β-galactosidases activity, glycosidases activity,
glycosyltransferases activity, hydrolases activity,
4-hydroxycinnamate decarboxylases activity,
β-lactamases activity, phosphatases activity,
sulfatases activity; treating cancer/antitumor
activity |
| InChI | InChI=1S/C10H6O5/c11-6-2-1-5-3-7(9(12)13)10(14)15-8(5)4-6/h1-4,11H,(H,12,13) |
| InChIKey | LKLWLDOUZJEHDY-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C=C1C(O)=O |
Description and Uses
Suitable as pH-indicator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29329990 |







