BD3249145
2-(2-((2,6-Dichloro-4-hydroxyphenyl)amino)phenyl)aceticacid , 99+% , 64118-84-9
Synonym(s):
[2-(2,6-Dichloro-4-hydroxy-phenylamino)phenyl]acetic acid;4′-Hydroxy Diclofenac
CAS NO.:64118-84-9
Empirical Formula: C14H11Cl2NO3
Molecular Weight: 312.15
MDL number: MFCD01671980
EINECS: 626-698-2
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB7424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-185°C dec. |
| Boiling point: | 432.7±45.0 °C(Predicted) |
| Density | 1.520±0.06 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | -20°C |
| solubility | Soluble in DMSO, ethanol or methanol |
| pka | 4.17±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 4198042 |
| Stability: | Light Sensitive |
| Major Application | clinical testing |
| InChI | 1S/C14H11Cl2NO3/c15-10-6-9(18)7-11(16)14(10)17-12-4-2-1-3-8(12)5-13(19)20/h1-4,6-7,17-18H,5H2,(H,19,20) |
| InChIKey | KGVXVPRLBMWZLG-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccccc1Nc2c(Cl)cc(O)cc2Cl |
Description and Uses
4-hydroxy Diclofenac is a CYP2C9 metabolite of the NSAID diclofenac . By inhibiting COX and subsequently suppressing PGE2 synthesis, it demonstrates anti-inflammatory and analgesic properties.
A Cytochrome P450 2C9 (CYP2C9) metabolite of diclofenac
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335-H410 |
| Precautionary statements | P261-P273-P280-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T,N,Xn,F |
| Risk Statements | 25-37/38-41-50/53-36-20/21/22-11 |
| Safety Statements | 26-39-45-60-61-36/37-16 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AG6542800 |
| HazardClass | 6.1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |









