BD3257445
1-(1H-Imidazol-2-yl)ethanone , 97% , 53981-69-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB261.60 | In Stock |
|
| 1g | RMB654.40 | In Stock |
|
| 5g | RMB2207.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-138℃ |
| Boiling point: | 269.4±23.0 °C(Predicted) |
| Density | 1.190±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 11.11±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C5H6N2O/c1-4(8)5-6-2-3-7-5/h2-3H,1H3,(H,6,7) |
| InChIKey | OSMJIXXVEWORDJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1NC=CN=1)C |
Description and Uses
1-(1H-Imidazol-2-yl)ethanone is a useful research chemical compound used in the synthetic preparation of imidazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36 |
| Safety Statements | 26 |
| HS Code | 2933992000 |
