BD3269348
(-)-MenthoxyacetylChloride , 98% , 15356-62-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB984.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 136 °C / 12mmHg |
| Density | 1.033 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| optical activity | [α]25/D 10°, neat |
| InChI | 1S/C12H21ClO2/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | VNMCKLVHDJADEB-OUAUKWLOSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCC(Cl)=O |
| CAS DataBase Reference | 15356-62-4(CAS DataBase Reference) |
Description and Uses
(-)-Menthoxyacetyl chloride is used as a resolving agent for a variety of racemic mixtures (such as amino acids).
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29181990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
