BD3351645
Diethyldifluoromalonate , 98% , 680-65-9
CAS NO.：680-65-9
Empirical Formula: C7H10F2O4
Molecular Weight: 196.15
MDL number: MFCD00221617
EINECS: 676-755-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB68.80 | In Stock |
|
| 25g | RMB314.40 | In Stock |
|
| 100g | RMB1232.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 94-95°C 23mm |
| Density | 1,179 g/cm3 |
| refractive index | 1.38 |
| Flash point: | 94-95°C/23mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | liquid |
| color | Colourless |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1783527 |
| InChI | InChI=1S/C7H10F2O4/c1-3-12-5(10)7(8,9)6(11)13-4-2/h3-4H2,1-2H3 |
| InChIKey | WCRVWLHTROHXBB-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(F)(F)C(OCC)=O |
| CAS DataBase Reference | 680-65-9(CAS DataBase Reference) |
Description and Uses
Diethyl difluoromalonate is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-45-36-37 |
| RIDADR | 2810 |
| Hazard Note | Irritant |
| HS Code | 29171900 |
