BD3352045
1-(3-Aminopropyl)pyrrolidin-2-one , 95% , 7663-77-6
CAS NO.：7663-77-6
Empirical Formula: C7H14N2O
Molecular Weight: 142.2
MDL number: MFCD00003201
EINECS: 231-632-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB140.80 | In Stock |
|
| 5g | RMB491.20 | In Stock |
|
| 25g | RMB2215.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-123 °C1 mm Hg(lit.) |
| Density | 1.014 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.85±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.01 |
| color | Clear colorless to slightly brown |
| InChI | InChI=1S/C7H14N2O/c8-4-2-6-9-5-1-3-7(9)10/h1-6,8H2 |
| InChIKey | HJORCZCMNWLHMB-UHFFFAOYSA-N |
| SMILES | N1(CCCN)CCCC1=O |
| CAS DataBase Reference | 7663-77-6(CAS DataBase Reference) |
Description and Uses
1-(3-AMinopropyl)-2-pyrrolidinone can be used as a useful synthetic intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 3 |
| RTECS | UY5739500 |
| F | 9-34 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
