PRODUCT Properties
| Melting point: | 54-58 °C (lit.) |
| Boiling point: | 270.42°C (rough estimate) |
| Density | 1.1566 (rough estimate) |
| refractive index | 1.6057 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.57±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C10H8N2/c1-2-4-9(5-3-1)10-6-7-11-8-12-10/h1-8H |
| InChIKey | MKLQPIYLZMLAER-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C2=CC=CC=C2)=N1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| RTECS | UV9640000 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







