BD3362351
N1,N1,N4,N4-Tetramethylbutane-1,4-diamine , 98% , 111-51-3
Synonym(s):
N,N,N′,N′-Tetramethyl-1,4-diaminobutane;1,4-Bis(dimethylamino)butane;1,4-Bis(dimethylamino)-butane
CAS NO.:111-51-3
Empirical Formula: C8H20N2
Molecular Weight: 144.26
MDL number: MFCD00008338
EINECS: 203-878-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB27.20 | In Stock |
|
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB204.80 | In Stock |
|
| 5g | RMB876.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -100 °C |
| Boiling point: | 166-167 °C(lit.) |
| Density | 0.792 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 115 °F |
| storage temp. | Store below +30°C. |
| pka | 10.00±0.28(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Merck | 14,9226 |
| BRN | 1735538 |
| InChI | InChI=1S/C8H20N2/c1-9(2)7-5-6-8-10(3)4/h5-8H2,1-4H3 |
| InChIKey | VEAZEPMQWHPHAG-UHFFFAOYSA-N |
| SMILES | C(N(C)C)CCCN(C)C |
| CAS DataBase Reference | 111-51-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Butanediamine, N,N,N',N'-tetramethyl- (111-51-3) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2734 8/PG 2 |
| WGK Germany | 3 |
| RTECS | EJ7530000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29212900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








