BD3364551
(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthyl-2,2'-diylHydrogenPhosphate , 98%99%ee , 791616-62-1
CAS NO.:791616-62-1
Empirical Formula: C36H17F12O4P
Molecular Weight: 772.47
MDL number: MFCD08689863
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB384.00 | In Stock |
|
| 250mg | RMB779.20 | In Stock |
|
| 1g | RMB2356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-175 °C |
| Boiling point: | 722.1±70.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 1.09±0.20(Predicted) |
| color | white to light-yellow |
| optical activity | [α]20/D -220°, c = 1 in chloroform (typical) |
| InChIKey | DQORDVSQWPKAQJ-UHFFFAOYSA-N |
| SMILES | O1C2=C(C3=CC(C(F)(F)F)=CC(C(F)(F)F)=C3)C=C3C(=C2C2=C4C(C=CC=C4)=CC(C4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)=C2OP1(=O)O)C=CC=C3 |
Description and Uses
As a chiral Bronsted acid, BINOL- derived cyclic phosphoric acid (such as Akiyama chiral Bronsted acid) was also shown to be an efficient catalyst for the hydrophosphonylation of aldimines at room temperature.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-binaphthyl-2,2'-diylHydrogenPhosphate](https://img.chemicalbook.com/CAS/GIF/791616-62-1.gif)

![(R)-5,5',6,6',7,7',8,8'-Octahydro-3,3'-diphenyl-[1,1'-binaphthalene]-2,2'-diol](https://img.chemicalbook.com/CAS/20150408/GIF/396134-73-9.gif)
![(R)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthyl-2,2'-diylHydrogenPhosphate](https://img.chemicalbook.com/CAS/20180808/GIF/1011465-24-9.gif)
![(R)-3,3''-Bis[4-(2-naphthalenyl)phenyl]-[1,1''-binaphthalene]-2,2''-diol](https://img.chemicalbook.com/CAS/20180808/GIF/309934-86-9.gif)

![(11bR)-8,9,10,11,12,13,14,15-Octahydro-4-hydroxy-4-oxide-dinaphtho[2,1-d:1'',2''-f][1,3,2]dioxaphosphepin](https://img.chemicalbook.com/CAS/GIF/297752-25-1.gif)