BD3374251
4,4',4'',4'''-([1,1'-Biphenyl]-4,4'-diylbis(azanetriyl))tetrabenzaldehyde , 97% , 865448-72-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB322.40 | In Stock |
|
| 250mg | RMB492.00 | In Stock |
|
| 1g | RMB1247.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-182 °C(Solv: ethyl acetate (141-78-6); ligroine (8032-32-4)) |
| Boiling point: | 817.5±65.0 °C(Predicted) |
| Density | 1.295±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -8.02±0.60(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChIKey | HPVDCPGIWARHER-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N(C3=CC=C(C=C3)C=O)C3=CC=C(C=C3)C=O)C=C2)=CC=C(N(C2=CC=C(C=C2)C=O)C2=CC=C(C=C2)C=O)C=C1 |
Description and Uses
N,N,N',N'-Tetra(4-formylphenyl)benzidin is used as a monomer for the synthesis of COF materials: SIOC-COF-6.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |

![4,4',4'',4'''-([1,1'-Biphenyl]-4,4'-diylbis(azanetriyl))tetrabenzaldehyde](https://img.chemicalbook.com/CAS/GIF/865448-72-2.gif)





