BD3387251
Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)iron(III) , 98% , 14876-47-2
Synonym(s):
Fe(TMHD)3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB32.00 | In Stock |
|
| 250mg | RMB69.60 | In Stock |
|
| 1g | RMB193.60 | In Stock |
|
| 5g | RMB730.40 | In Stock |
|
| 25g | RMB3024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-185 °C(lit.) |
| Boiling point: | 300°C |
| Flash point: | 300°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystal |
| color | red |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/3C11H20O2.Fe/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b2*8-7+;8-7-; |
| InChIKey | NXBJVTQWYMSPSJ-GECNZSFWSA-K |
| SMILES | CC(C)(C)C(=O)\C=C(\O[Fe](O\C(=C\C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
Description and Uses
Precursor for the formation of BaFe12O19 thin films on Al2O3 (0001) substrates in preferential orientation with the c-axis perpendicular to the substrate. Precursor for aerosol-assisted CVD of mixed-conducting ceramic films of Sr-Co-Fe perovskite phases.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280g |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2914199090 |
| Storage Class | 11 - Combustible Solids |







![Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)europium(III) [NMR Shift Reagent]](https://img.chemicalbook.com/CAS/GIF/15522-71-1.gif)