BD3389945
4,4'-(Ethane-1,1-diyl)diphenol , 97% , 2081-08-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB76.00 | In Stock |
|
| 5g | RMB228.00 | In Stock |
|
| 25g | RMB800.00 | In Stock |
|
| 100g | RMB2640.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-127 °C(lit.) |
| Boiling point: | 215 °C(Press: 0.7 Torr) |
| Density | 1.171±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.10±0.10(Predicted) |
| color | White to Off-White |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C14H14O2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12/h2-10,15-16H,1H3 |
| InChIKey | HCNHNBLSNVSJTJ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(C1=CC=C(O)C=C1)C |
Description and Uses
Bisphenol E is a derivative of Bisphenol A (B519495) which is a monomer used for polycarbonate and epoxy resins. It is used to stabilize formulations and improve the oil retention capacity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2907.19.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
