BD3433645
9-Ethyl-9H-carbazole-3-carboxylicacid , 95% , 57102-98-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB709.60 | In Stock |
|
| 1g | RMB1770.40 | In Stock |
|
| 5g | RMB5312.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-231°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Brown |
| InChI | InChI=1S/C15H13NO2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15(17)18)7-8-14(12)16/h3-9H,2H2,1H3,(H,17,18) |
| InChIKey | QZQNANUJNRAGPZ-UHFFFAOYSA-N |
| SMILES | N1(CC)C2=C(C=CC=C2)C2=C1C=CC(C(O)=O)=C2 |
Description and Uses
9-Ethyl-9H-carbazole-3-carboxylic Acid is a useful reagent for the preparation of an oxime ester photoinitiator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |




