BD3462345
Pamidronicacid , 98% , 40391-99-9
Synonym(s):
N-[2-[[4-[3-[(1-Methylethyl)amino]-2-pyridinyl]-1-piperazinyl]carbonyl]-1H-indol-5-yl]methanesulfonamide mesylate;Rescriptor
CAS NO.：40391-99-9
Empirical Formula: C3H11NO7P2
Molecular Weight: 235.07
MDL number: MFCD00168777
EINECS: 254-905-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB296.00 | In Stock |
|
| 1g | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-228°C |
| Boiling point: | 658.7±65.0 °C(Predicted) |
| Density | 1.998±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Methanol (Very Slightly, Heated, Sonicated), Water (Slightly, Heated, Sonicated) |
| pka | 1.44±0.10(Predicted) |
| form | Solid |
| color | Light Brown to Beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C3H11NO7P2/c4-2-1-3(5,12(6,7)8)13(9,10)11/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11) |
| InChIKey | WRUUGTRCQOWXEG-UHFFFAOYSA-N |
| SMILES | C(P(=O)(O)O)(P(=O)(O)O)(O)CCN |
Description and Uses
A biphosphonate bone resorption inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| HS Code | 9999999999 |
