BD3464145
Dibutylcarbonate , 97% , 542-52-9
CAS NO.：542-52-9
Empirical Formula: C9H18O3
Molecular Weight: 174.24
MDL number: MFCD00043938
EINECS: 208-816-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB28.80 | In Stock |
|
| 25g | RMB35.20 | In Stock |
|
| 100g | RMB69.60 | In Stock |
|
| 500g | RMB244.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | bp 206.6° |
| Density | d420 0.9251; d425 0.9388 |
| refractive index | nD20 1.4117 |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C9H18O3/c1-3-5-7-11-9(10)12-8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | QLVWOKQMDLQXNN-UHFFFAOYSA-N |
| SMILES | C(OCCCC)(=O)OCCCC |
| EPA Substance Registry System | Carbonic acid, dibutyl ester (542-52-9) |
Description and Uses
Dibutyl Carbonate is a potential fuel substitute due to the observed decrease in CO2 emissions. Also used in CO2 catalytic activation.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H317-H318-H412 |
| Precautionary statements | P273-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P280-P305+P351+P338-P310 |
| HS Code | 2920.90.5100 |
