BD3492645
1-(Isopropylamino)-3-(2-(2-methoxyethyl)phenoxy)propan-2-ol , 95% , 163685-38-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB760.00 | In Stock |
|
| 250mg | RMB1140.00 | In Stock |
|
| 1g | RMB2280.00 | In Stock |
|
| 5g | RMB6440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64 - 66°C |
| Boiling point: | 398.6±37.0 °C(Predicted) |
| Density | 1.033 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.87±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-7-5-4-6-13(15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 |
| InChIKey | RQZBCLSVVDPFIC-UHFFFAOYSA-N |
| SMILES | N(C(C)C)CC(O)COc1c(cccc1)CCOC |
Description and Uses
ortho-Metoprolol (Metoprolol EP Impurity E) is a new byproduct detected in Metoprolol tartrate (M338790).
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Repr. 2 |





![1,3-Bis[(1-Methylethyl)aMino]-2-propanol Dihydrochloride](https://img.chemicalbook.com/CAS/20150408/GIF/73313-36-7.gif)
