BD3516745
3,4,5-Trichlorophenol , 95% , 609-19-8
CAS NO.:609-19-8
Empirical Formula: C6H3Cl3O
Molecular Weight: 197.45
MDL number: MFCD00130143
EINECS: 210-183-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB199.20 | In Stock |
|
| 250mg | RMB312.80 | In Stock |
|
| 1g | RMB465.60 | In Stock |
|
| 5g | RMB2296.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-119℃ |
| Boiling point: | 275℃ |
| Density | 1.5701 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly, Heated) |
| pka | pK1:7.839 (25°C) |
| Appearance | Light brown to brown Solid |
| Stability: | Stable. Probably combustible. Incompatible with strong oxidizing agents, acid chlorides, acid anhydrides. |
| Major Application | environmental |
| InChI | InChI=1S/C6H3Cl3O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H |
| InChIKey | GBNHEBQXJVDXSW-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Cl)=C(Cl)C(Cl)=C1 |
| EPA Substance Registry System | 3,4,5-Trichlorophenol (609-19-8) |
Description and Uses
3,4,5-Trichlorophenol is a chlorinated phenol found in fungus. It also has possible toxic effects.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H318-H335-H410 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-36/37/38-50/53-41-37/38 |
| Safety Statements | 26-36-61-60 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | SN1650000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 609-19-8(Hazardous Substances Data) |









