PRODUCT Properties
| Melting point: | 163-165°C |
| Boiling point: | 300.9±35.0 °C(Predicted) |
| Density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 14.77±0.29(Predicted) |
| color | White to Almost white |
| λmax | 259nm(DMSO(5vol%))(lit.) |
| BRN | 972372 |
| InChI | InChI=1S/C8H10N2S/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10,11) |
| InChIKey | UCGFRIAOVLXVKL-UHFFFAOYSA-N |
| SMILES | N(CC1=CC=CC=C1)C(N)=S |
| CAS DataBase Reference | 621-83-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P280f-P301+P310-P330-P501a |
| Risk Statements | 22 |
| Safety Statements | 22-36/37 |
| RIDADR | UN 2811 6.1/PG III |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
