BD3522848
2,3,6-Trifluoropyridine , 99% , 3512-18-3
CAS NO.：3512-18-3
Empirical Formula: C5H2F3N
Molecular Weight: 133.07
MDL number: MFCD03001158
EINECS: 680-721-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB298.40 | In Stock |
|
| 5g | RMB1128.00 | In Stock |
|
| 25g | RMB4717.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-116 °C |
| Boiling point: | 100-102°C |
| Density | 1,499 g/cm3 |
| refractive index | 1.42 |
| Flash point: | 30°C |
| storage temp. | 2-8°C |
| form | liquid |
| pka | -8.51±0.10(Predicted) |
| Specific Gravity | 1.499 |
| color | Clear, red |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1365146 |
| InChI | InChI=1S/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| InChIKey | HRLIANGJWPJFKW-UHFFFAOYSA-N |
| SMILES | C1(F)=NC(F)=CC=C1F |
| CAS DataBase Reference | 3512-18-3(CAS DataBase Reference) |
Description and Uses
2,3,6-Trifluoropyridine is used as an intermediate in organic syntheses and in pharmaceuticals.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,F,C |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36/37/39-37 |
| RIDADR | 1993 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2933399990 |
