BD3534145
4-Amino-2,3-dihydro-1H-isoindol-1-one , 95% , 366452-98-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB167.20 | In Stock |
|
| 250mg | RMB332.00 | In Stock |
|
| 1g | RMB655.20 | In Stock |
|
| 5g | RMB2164.80 | In Stock |
|
| 10g | RMB3720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-230° |
| Boiling point: | 489.8±45.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 14.24±0.20(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C8H8N2O/c9-7-3-1-2-5-6(7)4-10-8(5)11/h1-3H,4,9H2,(H,10,11) |
| InChIKey | GZRGLZWHIFBBLS-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C(N)=CC=C2)CN1 |
Description and Uses
4-Aminoisoindolin-1-one is s a reactant that has been used in the synthesis of 4-(N-acyl)-2,3-dihydro-1H-isoindol-1-ones as potent inhibitors of poly(ADP-ribose) polymerase-1 (PARP-1).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
