BD3535548
2,4-Difluoro-3-methoxybenzoicacid , 98% , 178974-97-5
CAS NO.：178974-97-5
Empirical Formula: C8H6F2O3
Molecular Weight: 188.13
MDL number: MFCD02258905
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195°C |
| Boiling point: | 298.7±35.0 °C(Predicted) |
| Density | 1.399±0.06 g/cm3(Predicted) |
| refractive index | n20D 1.51 (Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.09±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C8H6F2O3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3H,1H3,(H,11,12) |
| InChIKey | KWLIGHXPUYUTBH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(OC)=C1F |
| CAS DataBase Reference | 178974-97-5(CAS DataBase Reference) |
Description and Uses
2,4-Difluoro-3-methoxybenzoic acid is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HS Code | 2916399090 |
