BD3545745
(R)-3-(Benzyloxy)propane-1,2-diol , 98% , 56552-80-8
Synonym(s):
(R)-Glycerol 1-benzyl ether;3-O-Benzyl-sn-glycerol;3-Benzyl-sn-glycerol
CAS NO.：56552-80-8
Empirical Formula: C10H14O3
Molecular Weight: 182.22
MDL number: MFCD00067260
EINECS: 225-358-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB66.40 | In Stock |
|
| 250mg | RMB124.00 | In Stock |
|
| 1g | RMB306.40 | In Stock |
|
| 5g | RMB1079.20 | In Stock |
|
| 25g | RMB3836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-29 °C(lit.) |
| Boiling point: | 140-145 |
| alpha | 5.5o (C=20 IN CHLOROFORM) |
| Density | 1.140 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 13.65±0.20(Predicted) |
| color | Colorless to Light yellow |
| optical activity | [α]20/D +5.5°, c = 20 in chloroform |
| BRN | 2048922 |
| Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H14O3/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-/m1/s1 |
| InChIKey | LWCIBYRXSHRIAP-SNVBAGLBSA-N |
| SMILES | C(O)[C@@H](O)COCC1=CC=CC=C1 |
| CAS DataBase Reference | 56552-80-8(CAS DataBase Reference) |
Description and Uses
Employed in the synthesis of a cyclopropyl chiron used in the preparation of 2,3-methanoamino acids. Chiral building block in the synthesis of petrosynes and biologically important phospholipid analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | TY3180000 |
| F | 3-9 |
| HS Code | 2909498090 |
