BD3552745
2-(1H-Imidazol-5-yl)aceticacid , 95% , 645-65-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB313.60 | In Stock |
|
| 250mg | RMB551.20 | In Stock |
|
| 1g | RMB1377.60 | In Stock |
|
| 5g | RMB4821.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | Solid |
| Boiling point: | 447.3±20.0 °C(Predicted) |
| Density | 1.426±0.06 g/cm3(Predicted) |
| Melting point: | 217-219 °C (decomp) |
| pka | 3.60±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C5H6N2O2/c8-5(9)1-4-2-6-3-7-4/h2-3H,1H2,(H,6,7)(H,8,9) |
| InChIKey | PRJKNHOMHKJCEJ-UHFFFAOYSA-N |
| SMILES | C1NC(CC(O)=O)=CN=1 |
Description and Uses
Imidazoleacetic acid is an endogenous ligand that stimulates imidazole receptors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
