BD3559948
(1S,2S)-2-Amino-1-phenyl-1,3-propanediol , 98% , 28143-91-1
Synonym(s):
L -(+)-threo-2-Amino-1-phenyl-1,3-propanediol
CAS NO.:28143-91-1
Empirical Formula: C9H13NO2
Molecular Weight: 167.21
MDL number: MFCD00069618
EINECS: 248-867-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB122.40 | In Stock |
|
| 1g | RMB335.20 | In Stock |
|
| 5g | RMB1168.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-113 °C (lit.) |
| Boiling point: | 295.79°C (rough estimate) |
| alpha | 35 º (c=1, 1N HCl) |
| Density | 1.1222 (rough estimate) |
| refractive index | 26.5 ° (C=1, MeOH) |
| storage temp. | 2-8°C |
| form | Crystals or Crystalline Powder |
| pka | 11.73±0.45(Predicted) |
| color | White to yellow |
| optical activity | [α]25/D +37°, c = 1 in 1 M HCl |
| biological source | human blood |
| BRN | 2804071 |
| InChI | InChI=1S/C9H13NO2/c10-8(6-11)9(12)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6,10H2/t8-,9-/m0/s1 |
| InChIKey | JUCGVCVPNPBJIG-IUCAKERBSA-N |
| SMILES | [C@@H](C1=CC=CC=C1)(O)[C@@H](N)CO |
| CAS DataBase Reference | 28143-91-1(CAS DataBase Reference) |
Description and Uses
Precursor to chiral 2-oxazolines. Auxiliary for the preparation of chiral 2-oxazolines from carboxylic acid derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29221985 |
| Storage Class | 11 - Combustible Solids |





