BD3581541
(4-Vinylphenyl)methanol , 95%(stabilizedwithTBC) , 1074-61-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB59.20 | In Stock |
|
| 250mg | RMB121.60 | In Stock |
|
| 1g | RMB384.80 | In Stock |
|
| 5g | RMB1484.80 | In Stock |
|
| 25g | RMB4488.00 | In Stock |
|
| 100g | RMB13464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 132-137 °C(Press: 15 Torr) |
| Density | 1.038±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| pka | 14.38±0.10(Predicted) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C9H10O/c1-2-8-3-5-9(7-10)6-4-8/h2-6,10H,1,7H2 |
| InChIKey | CLECMSNCZUMKLM-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=C(C=C)C=C1 |
Description and Uses
(4-Vinylphenyl)methanol is a chlorine-containing organic compound that is used as an intermediate in the production of other chemicals. It is also used as a solvent, plasticizer, and stabilizer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
