BD3642245
(R)-1-(Benzyloxy)propan-2-ol , 95% , 89401-28-5
Synonym(s):
(R)-1-O-Benzylpropylene glycol
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB82.40 | In Stock |
|
| 1g | RMB238.40 | In Stock |
|
| 5g | RMB488.80 | In Stock |
|
| 10g | RMB825.60 | In Stock |
|
| 25g | RMB2012.00 | In Stock |
|
| 100g | RMB4656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 263.8±15.0 °C(Predicted) |
| Density | 1.027 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate (Slightly) |
| pka | 14.46±0.20(Predicted) |
| form | Oil |
| color | Colourless |
| optical activity | [α]20/D -14°, c = 1 in chloroform |
| InChI | InChI=1S/C10H14O2/c1-9(11)7-12-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | KJBPYIUAQLPHJG-SECBINFHSA-N |
| SMILES | C(OCC1=CC=CC=C1)[C@H](O)C |
Description and Uses
(R)-(-)-1-Benzyloxy-2-propanol is the R-isomer of 1-Benzyloxy-2-propanol (B287760), a compound used in the synthetic preparation of glucokinase activators for the treatment of diabetes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2909498090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
