BD3647545
1,1,1,3,3,3-Hexaethyldisiloxane , 97% , 994-49-0
CAS NO.：994-49-0
Empirical Formula: C12H30OSi2
Molecular Weight: 246.54
MDL number: MFCD00026693
EINECS: 213-619-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB83.20 | In Stock |
|
| 10g | RMB160.80 | In Stock |
|
| 25g | RMB355.20 | In Stock |
|
| 100g | RMB1336.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -115°C |
| Boiling point: | 231 °C |
| Density | 0.844 |
| refractive index | 1.4330 |
| Flash point: | 87°C |
| storage temp. | Sealed in dry,Room Temperature |
| Specific Gravity | 0.844 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible or difficult to mix with water. |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1750865 |
| InChI | InChI=1S/C12H30OSi2/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6/h7-12H2,1-6H3 |
| InChIKey | WILBTFWIBAOWLN-UHFFFAOYSA-N |
| SMILES | [Si](CC)(CC)(CC)O[Si](CC)(CC)CC |
| CAS DataBase Reference | 994-49-0(CAS DataBase Reference) |
| EPA Substance Registry System | Disiloxane, hexaethyl- (994-49-0) |
Description and Uses
Hexaethyldisiloxane is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25-23 |
| TSCA | Yes |
