BD3651145
Methyl(R)-N-Boc-2,2-dimethyloxazolidine-4-carboxylate , 97% , 95715-86-9
Synonym(s):
Methyl (R)-(+)-3-(tert-butoxycarbonyl)-2,2-dimethyl-4-oxazolidinecarboxylate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB48.80 | In Stock |
|
| 5g | RMB141.60 | In Stock |
|
| 25g | RMB655.20 | In Stock |
|
| 100g | RMB2573.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 89 °C/0.8 mmHg(lit.) |
| Density | 1.082 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.444(lit.) |
| Flash point: | 93 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate |
| pka | -3.58±0.60(Predicted) |
| form | Oil |
| color | Yellow |
| optical activity | [α]20/D +54°, c = 1.3 in chloroform |
| InChI | 1S/C12H21NO5/c1-11(2,3)18-10(15)13-8(9(14)16-6)7-17-12(13,4)5/h8H,7H2,1-6H3/t8-/m1/s1 |
| InChIKey | ZNBUXTFASGDVCL-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
Description and Uses
Intermediate in the preparation of various enzymatic inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







