BD3653748
2-(Piperazin-1-yl)benzo[d]thiazole , 97% , 55745-83-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB198.40 | In Stock |
|
| 1g | RMB464.00 | In Stock |
|
| 5g | RMB1596.00 | In Stock |
|
| 10g | RMB2680.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-79℃ |
| Boiling point: | 370.5±52.0 °C(Predicted) |
| Density | 1.256 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 8.33±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C11H13N3S/c1-2-4-10-9(3-1)13-11(15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 |
| InChIKey | LLQMZXMBCQNMJV-UHFFFAOYSA-N |
| SMILES | C1(N2CCNCC2)=NC3=CC=CC=C3S1 |
| CAS DataBase Reference | 55745-83-0(CAS DataBase Reference) |
Description and Uses
2-(1-Piperazinyl)benzothiazole is a useful compound in the study of 1,8-Naphthyridone derivatives as potential inhibitor of HIV-1 replication.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934208090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |

![2-(Piperazin-1-yl)benzo[d]thiazole](https://img.chemicalbook.com/CAS/GIF/55745-83-0.gif)





