BD3684348
2,4,6-Trifluorophenol , 98% , 2268-17-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.00 | In Stock |
|
| 1g | RMB168.00 | In Stock |
|
| 5g | RMB542.40 | In Stock |
|
| 25g | RMB1848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-51 °C (lit.) |
| Boiling point: | 128.1±35.0 °C(Predicted) |
| Density | 1.4585 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystalline needles |
| pka | 7.47±0.23(Predicted) |
| color | White |
| BRN | 2089551 |
| InChI | InChI=1S/C6H3F3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChIKey | QQFWMPUXPLBWTG-UHFFFAOYSA-N |
| SMILES | C1(O)=C(F)C=C(F)C=C1F |
| CAS DataBase Reference | 2268-17-9(CAS DataBase Reference) |
Description and Uses
2,4,6-Trifluorophenol may be used in an indirect enzyme-linked immunosorbent assay (ELISA) for the biological monitoring of 2,4,6-trichlorophenol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29081000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





