PRODUCT Properties
| Boiling point: | 140°C/1013hPa |
| Density | 1.438 g/mL at 25 °C |
| vapor pressure | 0-0Pa at 25℃ |
| refractive index | n |
| storage temp. | Store below +30°C. |
| pka | -0.46±0.50(Predicted) |
| form | viscous liquid |
| PH | 1 (20°C in H2O, saturated aqueous solution) |
| BRN | 1727687 |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | 1S/C4H6O7S/c5-3(6)1-2(4(7)8)12(9,10)11/h2H,1H2,(H,5,6)(H,7,8)(H,9,10,11) |
| InChIKey | ULUAUXLGCMPNKK-UHFFFAOYSA-N |
| SMILES | OC(=O)CC(C(O)=O)S(O)(=O)=O |
| LogP | -0.463 at 25℃ and pH7 |
| EPA Substance Registry System | Sulfosuccinic acid (5138-18-1) |
Description and Uses
Sulfosuccinic Acid is cosmetic compound.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | - |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
