BD3819648
N-Ethyl-N-((triethoxysilyl)methyl)ethanamine , 95+% , 15180-47-9
CAS NO.：15180-47-9
Empirical Formula: C11H27NO3Si
Molecular Weight: 249.42
MDL number: MFCD01728991
EINECS: 518-047-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB48.80 | In Stock |
|
| 100g | RMB160.80 | In Stock |
|
| 500g | RMB560.80 | In Stock |
|
| 1000g | RMB952.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110-130°C (5 mmHg) |
| Density | 0,933 g/cm3 |
| refractive index | 1.4142 |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.91±0.25(Predicted) |
| Specific Gravity | 0.9336 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C11H27NO3Si/c1-6-12(7-2)11-16(13-8-3,14-9-4)15-10-5/h6-11H2,1-5H3 |
| InChIKey | UMXXGDJOCQSQBV-UHFFFAOYSA-N |
| SMILES | C(N(CC)C[Si](OCC)(OCC)OCC)C |
| CAS DataBase Reference | 15180-47-9(CAS DataBase Reference) |
Description and Uses
N-Ethyl-N-[(triethoxysilyl)methyl]ethanamine is used in the high-throughput identification of dominant negative polypeptides in yeast.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN3267 |
| TSCA | No |
| HazardClass | 8 |
| HS Code | 29319090 |
| Toxicity | mammal (species unspecified),LD50,unreported,12500mg/kg (12500mg/kg),Pharmaceutical Chemistry Journal Vol. 9, Pg. 165, 1975. |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
