BD3841848
1-((tert-Butyldimethylsilyl)oxy)propan-2-one , 98% , 74685-00-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB134.40 | In Stock |
|
| 25g | RMB592.80 | In Stock |
|
| 100g | RMB1954.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 35-38 °C/0.6 mmHg (lit.) |
| Density | 0.976 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.976 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C9H20O2Si/c1-8(10)7-11-12(5,6)9(2,3)4/h7H2,1-6H3 |
| InChIKey | LHYDYTSJUGPFLA-UHFFFAOYSA-N |
| SMILES | CC(=O)CO[Si](C)(C)C(C)(C)C |
Description and Uses
1-(tert-Butyldimethylsilyloxy)-2-propanone is also known as 1-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}acetone. Its enthalpy of vaporization at boiling point has been reported.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 10 - Combustible liquids |
