BD3905448
(3-Iodophenyl)methanamine , 98% , 696-40-2
CAS NO.:696-40-2
Empirical Formula: C7H8IN
Molecular Weight: 233.05
MDL number: MFCD00192227
EINECS: 625-616-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB263.20 | In Stock |
|
| 1g | RMB538.40 | In Stock |
|
| 5g | RMB2398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-249 °C(Solv: N,N-dimethylformamide (68-12-2)) |
| Boiling point: | 132 °C/8 mmHg (lit.) |
| Density | 1.748 g/mL at 25 °C (lit.) |
| refractive index | 1.638-1.64 |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Liquid |
| pka | 8.79±0.10(Predicted) |
| color | Clear light yellow |
| Water Solubility | Difficult to mix in water. |
| Sensitive | Air & Light Sensitive |
| BRN | 2689602 |
| InChI | InChI=1S/C7H8IN/c8-7-3-1-2-6(4-7)5-9/h1-4H,5,9H2 |
| InChIKey | LQLOGZQVKUNBRX-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=CC(I)=C1 |
| CAS DataBase Reference | 696-40-2(CAS DataBase Reference) |
Description and Uses
It is a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H334-H335-H361 |
| Precautionary statements | P201-P280-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43-63 |
| Safety Statements | 23-26-36/37/39 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Repr. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |






