BD3934146
Ethyl2-oxovalerate , 90% , 50461-74-0
CAS NO.：50461-74-0
Empirical Formula: C7H12O3
Molecular Weight: 144.17
MDL number: MFCD06410882
EINECS: 256-593-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5g | RMB154.40 | In Stock |
|
| 10g | RMB233.60 | In Stock |
|
| 25g | RMB429.60 | In Stock |
|
| 100g | RMB1304.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 182.5°C (estimate) |
| Density | 0.9985 |
| refractive index | 1.4170 |
| storage temp. | 2-8°C |
| solubility | Chloroform, DMSO, Methanol |
| form | Oil |
| color | Pale yellow |
| InChI | InChI=1S/C7H12O3/c1-3-5-6(8)7(9)10-4-2/h3-5H2,1-2H3 |
| InChIKey | YERWBBMSDMSDKT-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(=O)CCC |
| CAS DataBase Reference | 50461-74-0(CAS DataBase Reference) |
Description and Uses
Ethyl 2-oxopentanoate is used as a reagent to synthesize selective CB1 cannabinoid receptor antagonists. Ethyl 2-oxopentanoate is also used to synthesize derivatives of iminodiacid, an inhibitor of angiotensin converting enzyme.
Safety
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H341-H290 |
| Precautionary statements | P501-P260-P202-P234-P201-P264-P280-P390-P308+P313-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| HS Code | 2918300090 |
