BD3967146
Parecoxib , 98% , 198470-84-7
CAS NO.：198470-84-7
Empirical Formula: C19H18N2O4S
Molecular Weight: 370.42
MDL number: MFCD08141856
EINECS: 803-261-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB170.40 | In Stock |
|
| 5g | RMB594.40 | In Stock |
|
| 25g | RMB1783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148.9-151° |
| Density | 1.264 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.08±0.10(Predicted) |
| color | White to off-white |
| BRN | 8640266 |
| InChI | InChI=1S/C19H18N2O4S/c1-3-17(22)21-26(23,24)16-11-9-14(10-12-16)18-13(2)25-20-19(18)15-7-5-4-6-8-15/h4-12H,3H2,1-2H3,(H,21,22) |
| InChIKey | TZRHLKRLEZJVIJ-UHFFFAOYSA-N |
| SMILES | C(NS(C1=CC=C(C2=C(C)ON=C2C2=CC=CC=C2)C=C1)(=O)=O)(=O)CC |
Description and Uses
Anti-inflammatory; analgesic (cyclooxygenase COX-2 inhibitor).
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361fd-H373 |
| Precautionary statements | P201-P202-P260-P280-P308+P313-P405 |
| Hazard Codes | Xn,N |
| Risk Statements | 63-48/22-51/53 |
| Safety Statements | 36/37-61 |
| WGK Germany | 3 |
| RTECS | TX1478700 |
