![2-Chlorobenzo[d]isothiazol-3(2H)-one1,1-dioxide](https://img.chemicalbook.com/CAS/GIF/14070-51-0.gif)
BD4552441
2-Chlorobenzo[d]isothiazol-3(2H)-one1,1-dioxide , 95% , 14070-51-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB46.40 | In Stock |
|
| 5g | RMB84.80 | In Stock |
|
| 10g | RMB164.80 | In Stock |
|
| 25g | RMB240.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-152 °C (lit.) |
| Boiling point: | 388.6±25.0 °C(Predicted) |
| Density | 1.77±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Toluene[soluble in] |
| solubility | soluble in Toluene |
| form | powder to crystaline |
| pka | -24.37±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H4ClNO3S/c8-9-7(10)5-3-1-2-4-6(5)13(9,11)12/h1-4H |
| InChIKey | VKWMGUNWDFIWNW-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)C2=C(C=CC=C2)C(=O)N1Cl |
| CAS DataBase Reference | 14070-51-0 |
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H351 |
| Precautionary statements | P280 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 22-26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29251100 |
