PRODUCT Properties
| Melting point: | -37°C |
| Boiling point: | 105 °C/15 mmHg (lit.) |
| Density | 0.961 g/mL at 25 °C (lit.) |
| refractive index | 1.4340 |
| Flash point: | 107°C/17mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 4.76±0.10(Predicted) |
| Specific Gravity | 0.961 |
| color | Colorless to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 1743172 |
| InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) |
| InChIKey | XUDOZULIAWNMIU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCC=C |
| LogP | 1.256 (est) |
| CAS DataBase Reference | 1577-22-6(CAS DataBase Reference) |
Description and Uses
5-Hexenoic acid is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29161900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
