BD4631641
6-Chloro-5-nitropyrimidin-4-amine , 95% , 4316-94-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB129.60 | In Stock |
|
| 1g | RMB332.00 | In Stock |
|
| 5g | RMB1004.00 | In Stock |
|
| 25g | RMB3739.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-156 °C |
| Boiling point: | 394.7±37.0 °C(Predicted) |
| Density | 1.712±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | -1.07±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C4H3ClN4O2/c5-3-2(9(10)11)4(6)8-1-7-3/h1H,(H2,6,7,8) |
| InChIKey | BWLOHIMQWHFSQF-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C([N+]([O-])=O)C(N)=N1 |
Description and Uses
6-Chloro-5-nitropyrimidin-4-amine is a substituted pyrimidine with antifungal properties.
